C21H15N5O3 — CID 137254443
2-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]-4-nitrophenol (PubChem CID 137254443) has the molecular formula C21H15N5O3 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]-4-nitrophenol.
| Compound Name | 2-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]-4-nitrophenol |
|---|---|
| PubChem CID | 137254443 |
| Molecular Formula | C21H15N5O3 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-[(4,5-diphenyl-1H-imidazol-2-yl)diazenyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1ccc(O)c(/N=N/c2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)c1 |
| InChI | InChI=1S/C21H15N5O3/c27-18-12-11-16(26(28)29)13-17(18)24-25-21-22-19(14-7-3-1-4-8-14)20(23-21)15-9-5-2-6-10-15/h1-13,27H,(H,22,23)/b25-24+ |
| InChIKey | NJIHHQQGTHFVBC-OCOZRVBESA-N |
| XLogP | 5.77 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|