C17H15Cl2N5O3S — CID 157273292
[4-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-2,5-dichlorophenyl]methanesulfonic acid (PubChem CID 157273292) has the molecular formula C17H15Cl2N5O3S and a molecular weight of 440.31 g/mol. Its IUPAC name is [4-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-2,5-dichlorophenyl]methanesulfonic acid.
| Compound Name | [4-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-2,5-dichlorophenyl]methanesulfonic acid |
|---|---|
| PubChem CID | 157273292 |
| Molecular Formula | C17H15Cl2N5O3S |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | [4-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-2,5-dichlorophenyl]methanesulfonic acid |
| SMILES | Cc1nn(-c2ccccc2)c(N)c1/N=N/c1cc(Cl)c(CS(=O)(=O)O)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N5O3S/c1-10-16(17(20)24(23-10)12-5-3-2-4-6-12)22-21-15-8-13(18)11(7-14(15)19)9-28(25,26)27/h2-8H,9,20H2,1H3,(H,25,26,27)/b22-21+ |
| InChIKey | VAQSYWYKLKXXIC-QURGRASLSA-N |
| XLogP | 4.87 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|