C20H22N6O5S — CID 154549663
3-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-1,6-dimethyl-6-nitrocycloocta-2,4,7-triene-1-sulfonic acid (PubChem CID 154549663) has the molecular formula C20H22N6O5S and a molecular weight of 458.50 g/mol. Its IUPAC name is 3-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-1,6-dimethyl-6-nitrocycloocta-2,4,7-triene-1-sulfonic acid.
| Compound Name | 3-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-1,6-dimethyl-6-nitrocycloocta-2,4,7-triene-1-sulfonic acid |
|---|---|
| PubChem CID | 154549663 |
| Molecular Formula | C20H22N6O5S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 3-[(5-amino-3-methyl-1-phenylpyrazol-4-yl)diazenyl]-1,6-dimethyl-6-nitrocycloocta-2,4,7-triene-1-sulfonic acid |
| SMILES | Cc1nn(-c2ccccc2)c(N)c1/N=N/C1=CC(C)(S(=O)(=O)O)C=CC(C)([N+](=O)[O-])C=C1 |
| InChI | InChI=1S/C20H22N6O5S/c1-14-17(18(21)25(24-14)16-7-5-4-6-8-16)23-22-15-9-10-19(2,26(27)28)11-12-20(3,13-15)32(29,30)31/h4-13H,21H2,1-3H3,(H,29,30,31)/b10-9?,12-11?,15-13?,23-22+ |
| InChIKey | DYOJMHCHPSQTFD-CEOJTXPFSA-N |
| XLogP | 3.54 |
| TPSA | 166.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|