C18H15N4O2- — CID 7403952
4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)diazenyl]benzoate (PubChem CID 7403952) has the molecular formula C18H15N4O2- and a molecular weight of 319.34 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)diazenyl]benzoate.
| Compound Name | 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 7403952 |
| Molecular Formula | C18H15N4O2- |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)diazenyl]benzoate |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/N=N/c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N4O2/c1-12-17(13(2)22(21-12)16-6-4-3-5-7-16)20-19-15-10-8-14(9-11-15)18(23)24/h3-11H,1-2H3,(H,23,24)/p-1/b20-19+ |
| InChIKey | NRKHFEIHPKIYNZ-FMQUCBEESA-M |
| XLogP | 3.27 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|