C22H24N4O2 — CID 3117409
ethyl 4-[[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]diazenyl]benzoate (PubChem CID 3117409) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is ethyl 4-[[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]diazenyl]benzoate.
| Compound Name | ethyl 4-[[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]diazenyl]benzoate |
|---|---|
| PubChem CID | 3117409 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | ethyl 4-[[1-(3,4-dimethylphenyl)-3,5-dimethylpyrazol-4-yl]diazenyl]benzoate |
| SMILES | CCOC(=O)c1ccc(/N=N/c2c(C)nn(-c3ccc(C)c(C)c3)c2C)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-6-28-22(27)18-8-10-19(11-9-18)23-24-21-16(4)25-26(17(21)5)20-12-7-14(2)15(3)13-20/h7-13H,6H2,1-5H3/b24-23+ |
| InChIKey | YZIMOBLUDNARGO-WCWDXBQESA-N |
| XLogP | 5.70 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|