C17H13N2O2- — CID 4739263
5-methyl-1,3-diphenylpyrazole-4-carboxylate (PubChem CID 4739263) has the molecular formula C17H13N2O2- and a molecular weight of 277.30 g/mol. Its IUPAC name is 5-methyl-1,3-diphenylpyrazole-4-carboxylate.
| Compound Name | 5-methyl-1,3-diphenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4739263 |
| Molecular Formula | C17H13N2O2- |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-methyl-1,3-diphenylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)[O-])c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C17H14N2O2/c1-12-15(17(20)21)16(13-8-4-2-5-9-13)18-19(12)14-10-6-3-7-11-14/h2-11H,1H3,(H,20,21)/p-1 |
| InChIKey | FWIYNXGMTSTQBJ-UHFFFAOYSA-M |
| XLogP | 2.21 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |