C24H28N4O — CID 4016241
5-methyl-1,3-diphenyl-N-(2-piperidin-1-ylethyl)pyrazole-4-carboxamide (PubChem CID 4016241) has the molecular formula C24H28N4O and a molecular weight of 388.51 g/mol. Its IUPAC name is 5-methyl-1,3-diphenyl-N-(2-piperidin-1-ylethyl)pyrazole-4-carboxamide.
| Compound Name | 5-methyl-1,3-diphenyl-N-(2-piperidin-1-ylethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 4016241 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 5-methyl-1,3-diphenyl-N-(2-piperidin-1-ylethyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCCCC2)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C24H28N4O/c1-19-22(24(29)25-15-18-27-16-9-4-10-17-27)23(20-11-5-2-6-12-20)26-28(19)21-13-7-3-8-14-21/h2-3,5-8,11-14H,4,9-10,15-18H2,1H3,(H,25,29) |
| InChIKey | KOXDDORACOTGBI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |