C21H21N3O2 — CID 3079318
(5-methyl-1,3-diphenylpyrazol-4-yl)-morpholin-4-ylmethanone (PubChem CID 3079318) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is (5-methyl-1,3-diphenylpyrazol-4-yl)-morpholin-4-ylmethanone.
| Compound Name | (5-methyl-1,3-diphenylpyrazol-4-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 3079318 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (5-methyl-1,3-diphenylpyrazol-4-yl)-morpholin-4-ylmethanone |
| SMILES | Cc1c(C(=O)N2CCOCC2)c(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C21H21N3O2/c1-16-19(21(25)23-12-14-26-15-13-23)20(17-8-4-2-5-9-17)22-24(16)18-10-6-3-7-11-18/h2-11H,12-15H2,1H3 |
| InChIKey | ABMKWVIZWAIYEZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |