C25H23N3O — CID 19473295
N-(2,3-dimethylphenyl)-5-methyl-1,3-diphenylpyrazole-4-carboxamide (PubChem CID 19473295) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-5-methyl-1,3-diphenylpyrazole-4-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-5-methyl-1,3-diphenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19473295 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-5-methyl-1,3-diphenylpyrazole-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2c(-c3ccccc3)nn(-c3ccccc3)c2C)c1C |
| InChI | InChI=1S/C25H23N3O/c1-17-11-10-16-22(18(17)2)26-25(29)23-19(3)28(21-14-8-5-9-15-21)27-24(23)20-12-6-4-7-13-20/h4-16H,1-3H3,(H,26,29) |
| InChIKey | XBHABKHOCLHQQT-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |