C14H20N2Si — CID 130535844
(3,5-dimethyl-1-phenylpyrazol-4-yl)-trimethylsilane (PubChem CID 130535844) has the molecular formula C14H20N2Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (3,5-dimethyl-1-phenylpyrazol-4-yl)-trimethylsilane.
| Compound Name | (3,5-dimethyl-1-phenylpyrazol-4-yl)-trimethylsilane |
|---|---|
| PubChem CID | 130535844 |
| Molecular Formula | C14H20N2Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | (3,5-dimethyl-1-phenylpyrazol-4-yl)-trimethylsilane |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1[Si](C)(C)C |
| InChI | InChI=1S/C14H20N2Si/c1-11-14(17(3,4)5)12(2)16(15-11)13-9-7-6-8-10-13/h6-10H,1-5H3 |
| InChIKey | NZXRXOYGROOBDD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|