C14H12F6N2O — CID 88773612
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 88773612) has the molecular formula C14H12F6N2O and a molecular weight of 338.25 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 88773612 |
| Molecular Formula | C14H12F6N2O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H12F6N2O/c1-8-11(12(23,13(15,16)17)14(18,19)20)9(2)22(21-8)10-6-4-3-5-7-10/h3-7,23H,1-2H3 |
| InChIKey | RBOHIQNCNYBYHB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |