C18H18N2O — CID 1478286
4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]phenol (PubChem CID 1478286) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]phenol.
| Compound Name | 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]phenol |
|---|---|
| PubChem CID | 1478286 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 4-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methyl]phenol |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H18N2O/c1-13-18(12-15-8-10-17(21)11-9-15)14(2)20(19-13)16-6-4-3-5-7-16/h3-11,21H,12H2,1-2H3 |
| InChIKey | OGWWPFKGGKBQIC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |