C27H28N2O2 — CID 10693025
4-[2-hydroperoxy-2,2-bis(4-methylphenyl)ethyl]-3,5-dimethyl-1-phenylpyrazole (PubChem CID 10693025) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 4-[2-hydroperoxy-2,2-bis(4-methylphenyl)ethyl]-3,5-dimethyl-1-phenylpyrazole.
| Compound Name | 4-[2-hydroperoxy-2,2-bis(4-methylphenyl)ethyl]-3,5-dimethyl-1-phenylpyrazole |
|---|---|
| PubChem CID | 10693025 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 4-[2-hydroperoxy-2,2-bis(4-methylphenyl)ethyl]-3,5-dimethyl-1-phenylpyrazole |
| SMILES | Cc1ccc(C(Cc2c(C)nn(-c3ccccc3)c2C)(OO)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C27H28N2O2/c1-19-10-14-23(15-11-19)27(31-30,24-16-12-20(2)13-17-24)18-26-21(3)28-29(22(26)4)25-8-6-5-7-9-25/h5-17,30H,18H2,1-4H3 |
| InChIKey | KFVMPWOHAPXCDL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|