C25H23ClN2O2 — CID 10526086
1-(4-chlorophenyl)-4-(2-hydroperoxy-2,2-diphenylethyl)-3,5-dimethylpyrazole (PubChem CID 10526086) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-(2-hydroperoxy-2,2-diphenylethyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(4-chlorophenyl)-4-(2-hydroperoxy-2,2-diphenylethyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 10526086 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 1-(4-chlorophenyl)-4-(2-hydroperoxy-2,2-diphenylethyl)-3,5-dimethylpyrazole |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)c(C)c1CC(OO)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H23ClN2O2/c1-18-24(19(2)28(27-18)23-15-13-22(26)14-16-23)17-25(30-29,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,29H,17H2,1-2H3 |
| InChIKey | VTVSNBZAJYKSSS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|