C12H13N2Y- — CID 176877441
4-methanidyl-3,5-dimethyl-1-phenylpyrazole;yttrium (PubChem CID 176877441) has the molecular formula C12H13N2Y- and a molecular weight of 274.16 g/mol. Its IUPAC name is 4-methanidyl-3,5-dimethyl-1-phenylpyrazole;yttrium.
| Compound Name | 4-methanidyl-3,5-dimethyl-1-phenylpyrazole;yttrium |
|---|---|
| PubChem CID | 176877441 |
| Molecular Formula | C12H13N2Y- |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | 4-methanidyl-3,5-dimethyl-1-phenylpyrazole;yttrium |
| SMILES | [CH2-]c1c(C)nn(-c2ccccc2)c1C.[Y] |
| InChI | InChI=1S/C12H13N2.Y/c1-9-10(2)13-14(11(9)3)12-7-5-4-6-8-12;/h4-8H,1H2,2-3H3;/q-1; |
| InChIKey | BPZJPFDGVMMVEO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|