C13H17N2O2P — CID 11865238
4-[methoxy(methyl)phosphoryl]-3,5-dimethyl-1-phenylpyrazole (PubChem CID 11865238) has the molecular formula C13H17N2O2P and a molecular weight of 264.26 g/mol. Its IUPAC name is 4-[methoxy(methyl)phosphoryl]-3,5-dimethyl-1-phenylpyrazole.
| Compound Name | 4-[methoxy(methyl)phosphoryl]-3,5-dimethyl-1-phenylpyrazole |
|---|---|
| PubChem CID | 11865238 |
| Molecular Formula | C13H17N2O2P |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 4-[methoxy(methyl)phosphoryl]-3,5-dimethyl-1-phenylpyrazole |
| SMILES | CO[P@@](C)(=O)c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C13H17N2O2P/c1-10-13(18(4,16)17-3)11(2)15(14-10)12-8-6-5-7-9-12/h5-9H,1-4H3/t18-/m1/s1 |
| InChIKey | YLHCIXWPRRKFQM-GOSISDBHSA-N |
| XLogP | 2.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|