C21H23N3O4 — CID 51275514
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,4,5-trimethoxybenzamide (PubChem CID 51275514) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,4,5-trimethoxybenzamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 51275514 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2c(C)nn(-c3ccccc3)c2C)cc1OC |
| InChI | InChI=1S/C21H23N3O4/c1-13-20(14(2)24(23-13)15-9-7-6-8-10-15)22-21(25)16-11-18(27-4)19(28-5)12-17(16)26-3/h6-12H,1-5H3,(H,22,25) |
| InChIKey | URUGLDDFLCLAPU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |