C18H15ClN4O3 — CID 16960970
5-chloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-nitrobenzamide (PubChem CID 16960970) has the molecular formula C18H15ClN4O3 and a molecular weight of 370.80 g/mol. Its IUPAC name is 5-chloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-nitrobenzamide.
| Compound Name | 5-chloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 16960970 |
| Molecular Formula | C18H15ClN4O3 |
| Molecular Weight | 370.80 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 5-chloro-N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-nitrobenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15ClN4O3/c1-11-17(12(2)22(21-11)14-6-4-3-5-7-14)20-18(24)15-10-13(19)8-9-16(15)23(25)26/h3-10H,1-2H3,(H,20,24) |
| InChIKey | MVKOJCSLPKLWEB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|