C24H21N5O5S — CID 21369279
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(2-nitrophenyl)sulfonylamino]benzamide (PubChem CID 21369279) has the molecular formula C24H21N5O5S and a molecular weight of 491.53 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(2-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(2-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 21369279 |
| Molecular Formula | C24H21N5O5S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(2-nitrophenyl)sulfonylamino]benzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)c1ccccc1NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21N5O5S/c1-16-23(17(2)28(26-16)18-10-4-3-5-11-18)25-24(30)19-12-6-7-13-20(19)27-35(33,34)22-15-9-8-14-21(22)29(31)32/h3-15,27H,1-2H3,(H,25,30) |
| InChIKey | RRKXUJUJMFKFBY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|