C25H21N5O4 — CID 21369267
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(4-nitrobenzoyl)amino]benzamide (PubChem CID 21369267) has the molecular formula C25H21N5O4 and a molecular weight of 455.47 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(4-nitrobenzoyl)amino]benzamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(4-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 21369267 |
| Molecular Formula | C25H21N5O4 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[(4-nitrobenzoyl)amino]benzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)c1ccccc1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H21N5O4/c1-16-23(17(2)29(28-16)19-8-4-3-5-9-19)27-25(32)21-10-6-7-11-22(21)26-24(31)18-12-14-20(15-13-18)30(33)34/h3-15H,1-2H3,(H,26,31)(H,27,32) |
| InChIKey | IFLVEVMVEGJEPT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|