C25H22N4O2S — CID 21369273
N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide (PubChem CID 21369273) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide.
| Compound Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 21369273 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]benzamide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1NC(=O)c1ccccc1NC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C25H22N4O2S/c1-17-24(18(2)29(28-17)19-9-4-3-5-10-19)27-25(31)21-12-6-7-13-22(21)26-23(30)15-14-20-11-8-16-32-20/h3-16H,1-2H3,(H,26,30)(H,27,31)/b15-14+ |
| InChIKey | GJSDQXMSVOXGBR-CCEZHUSRSA-N |
| XLogP | 5.45 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|