C14H11NO3S — CID 3063368
2-(3-thiophen-2-ylprop-2-enoylamino)benzoic acid (PubChem CID 3063368) has the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-(3-thiophen-2-ylprop-2-enoylamino)benzoic acid.
| Compound Name | 2-(3-thiophen-2-ylprop-2-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 3063368 |
| Molecular Formula | C14H11NO3S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-(3-thiophen-2-ylprop-2-enoylamino)benzoic acid |
| SMILES | O=C(C=Cc1cccs1)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C14H11NO3S/c16-13(8-7-10-4-3-9-19-10)15-12-6-2-1-5-11(12)14(17)18/h1-9H,(H,15,16)(H,17,18) |
| InChIKey | GERZVEHIQIUMRH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|