C20H22N2O2S — CID 6234393
(E)-N-[2-(azepane-1-carbonyl)phenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 6234393) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is (E)-N-[2-(azepane-1-carbonyl)phenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(azepane-1-carbonyl)phenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 6234393 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | (E)-N-[2-(azepane-1-carbonyl)phenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccs1)Nc1ccccc1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C20H22N2O2S/c23-19(12-11-16-8-7-15-25-16)21-18-10-4-3-9-17(18)20(24)22-13-5-1-2-6-14-22/h3-4,7-12,15H,1-2,5-6,13-14H2,(H,21,23)/b12-11+ |
| InChIKey | VIMMSVQHQGUUIM-VAWYXSNFSA-N |
| XLogP | 4.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|