C21H21N6PS — CID 2999024
(3,5-dimethyl-1-phenylpyrazol-4-yl)-bis(1-ethenylimidazol-2-yl)-sulfanylidene-lambda5-phosphane (PubChem CID 2999024) has the molecular formula C21H21N6PS and a molecular weight of 420.48 g/mol. Its IUPAC name is (3,5-dimethyl-1-phenylpyrazol-4-yl)-bis(1-ethenylimidazol-2-yl)-sulfanylidene-lambda5-phosphane.
| Compound Name | (3,5-dimethyl-1-phenylpyrazol-4-yl)-bis(1-ethenylimidazol-2-yl)-sulfanylidene-lambda5-phosphane |
|---|---|
| PubChem CID | 2999024 |
| Molecular Formula | C21H21N6PS |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (3,5-dimethyl-1-phenylpyrazol-4-yl)-bis(1-ethenylimidazol-2-yl)-sulfanylidene-lambda5-phosphane |
| SMILES | C=Cn1ccnc1P(=S)(c1c(C)nn(-c2ccccc2)c1C)c1nccn1C=C |
| InChI | InChI=1S/C21H21N6PS/c1-5-25-14-12-22-20(25)28(29,21-23-13-15-26(21)6-2)19-16(3)24-27(17(19)4)18-10-8-7-9-11-18/h5-15H,1-2H2,3-4H3 |
| InChIKey | OWJYZVYHLGHHMK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|