C17H21N3O2S — CID 19682229
3,5-dimethyl-1-phenyl-N,N-bis(prop-2-enyl)pyrazole-4-sulfonamide (PubChem CID 19682229) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 3,5-dimethyl-1-phenyl-N,N-bis(prop-2-enyl)pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-1-phenyl-N,N-bis(prop-2-enyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19682229 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3,5-dimethyl-1-phenyl-N,N-bis(prop-2-enyl)pyrazole-4-sulfonamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1c(C)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C17H21N3O2S/c1-5-12-19(13-6-2)23(21,22)17-14(3)18-20(15(17)4)16-10-8-7-9-11-16/h5-11H,1-2,12-13H2,3-4H3 |
| InChIKey | XLSJXWYROJHNCV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|