C15H21N3O2S — CID 110705697
N-benzyl-N-ethyl-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 110705697) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is N-benzyl-N-ethyl-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-benzyl-N-ethyl-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 110705697 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | N-benzyl-N-ethyl-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | CCN(Cc1ccccc1)S(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C15H21N3O2S/c1-5-18(11-14-9-7-6-8-10-14)21(19,20)15-12(2)16-17(4)13(15)3/h6-10H,5,11H2,1-4H3 |
| InChIKey | SFZMJPUMFWMEBG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |