C15H22N4O2S — CID 120584267
N-(2-aminoethyl)-N-benzyl-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 120584267) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2-aminoethyl)-N-benzyl-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 120584267 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N(CCN)Cc1ccccc1 |
| InChI | InChI=1S/C15H22N4O2S/c1-12-15(13(2)18(3)17-12)22(20,21)19(10-9-16)11-14-7-5-4-6-8-14/h4-8H,9-11,16H2,1-3H3 |
| InChIKey | PCOIXEFNFNUOSP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |