C10H19N3O2S — CID 19682136
N,N-diethyl-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 19682136) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is N,N-diethyl-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N,N-diethyl-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 19682136 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N,N-diethyl-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C10H19N3O2S/c1-6-13(7-2)16(14,15)10-8(3)11-12(5)9(10)4/h6-7H2,1-5H3 |
| InChIKey | LBDNPZZRFBWKQS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |