C9H18N4O2S — CID 105357885
3-amino-N,N-diethyl-1,5-dimethylpyrazole-4-sulfonamide (PubChem CID 105357885) has the molecular formula C9H18N4O2S and a molecular weight of 246.34 g/mol. Its IUPAC name is 3-amino-N,N-diethyl-1,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 3-amino-N,N-diethyl-1,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105357885 |
| Molecular Formula | C9H18N4O2S |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-amino-N,N-diethyl-1,5-dimethylpyrazole-4-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1c(N)nn(C)c1C |
| InChI | InChI=1S/C9H18N4O2S/c1-5-13(6-2)16(14,15)8-7(3)12(4)11-9(8)10/h5-6H2,1-4H3,(H2,10,11) |
| InChIKey | UCHUQFGYIJXECA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |