About 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride
1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride (PubChem CID 51051877) has the molecular formula C6H10Cl2N2O2S
and a molecular weight of 245.13 g/mol. Its IUPAC name is 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride.
Analyze 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride?
The IUPAC name of 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride (CID 51051877) is 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride.
What is the SMILES notation for 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride?
The canonical SMILES for 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride is Cc1nn(C)c(C)c1S(=O)(=O)Cl.Cl.
What is the InChIKey of 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride?
The InChIKey is NIQBSGRUIVPSHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2O2S.ClH/c1-4-6(12(7,10)11)5(2)9(3)8-4;/h1-3H3;1H.
What are the key properties of 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride?
1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride has a molecular weight of 245.13 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-trimethylpyrazole-4-sulfonyl chloride;hydrochloride is sourced from PubChem (CID 51051877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).