C5H8Cl2N2O3S — CID 174268222
5-chloro-1,3-dimethylpyrazole-4-sulfonic acid;hydrochloride (PubChem CID 174268222) has the molecular formula C5H8Cl2N2O3S and a molecular weight of 247.10 g/mol. Its IUPAC name is 5-chloro-1,3-dimethylpyrazole-4-sulfonic acid;hydrochloride.
| Compound Name | 5-chloro-1,3-dimethylpyrazole-4-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174268222 |
| Molecular Formula | C5H8Cl2N2O3S |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 245.96 |
| IUPAC Name | 5-chloro-1,3-dimethylpyrazole-4-sulfonic acid;hydrochloride |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)O.Cl |
| InChI | InChI=1S/C5H7ClN2O3S.ClH/c1-3-4(12(9,10)11)5(6)8(2)7-3;/h1-2H3,(H,9,10,11);1H |
| InChIKey | VDHHMGVZGOGMTH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|