C11H11ClN2O3S — CID 47315143
phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate (PubChem CID 47315143) has the molecular formula C11H11ClN2O3S and a molecular weight of 286.74 g/mol. Its IUPAC name is phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate.
| Compound Name | phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate |
|---|---|
| PubChem CID | 47315143 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H11ClN2O3S/c1-8-10(11(12)14(2)13-8)18(15,16)17-9-6-4-3-5-7-9/h3-7H,1-2H3 |
| InChIKey | OCVPBXORBCDUJQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|