About phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate
phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate (PubChem CID 47315143) has the molecular formula C11H11ClN2O3S
and a molecular weight of 286.74 g/mol. Its IUPAC name is phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate.
Molecular Properties
| Compound Name | phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate |
| PubChem CID | 47315143 |
| Molecular Formula | C11H11ClN2O3S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)Oc1ccccc1 |
| InChI | InChI=1S/C11H11ClN2O3S/c1-8-10(11(12)14(2)13-8)18(15,16)17-9-6-4-3-5-7-9/h3-7H,1-2H3 |
| InChIKey | OCVPBXORBCDUJQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate?
The IUPAC name of phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate (CID 47315143) is phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate.
What is the SMILES notation for phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate?
The canonical SMILES for phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate is Cc1nn(C)c(Cl)c1S(=O)(=O)Oc1ccccc1.
What is the InChIKey of phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate?
The InChIKey is OCVPBXORBCDUJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN2O3S/c1-8-10(11(12)14(2)13-8)18(15,16)17-9-6-4-3-5-7-9/h3-7H,1-2H3.
What are the key properties of phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate?
phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate has a molecular weight of 286.74 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 5-chloro-1,3-dimethylpyrazole-4-sulfonate is sourced from PubChem (CID 47315143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).