C23H26ClN3O3S — CID 3854256
[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]-diphenylmethanol (PubChem CID 3854256) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is [1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]-diphenylmethanol.
| Compound Name | [1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]-diphenylmethanol |
|---|---|
| PubChem CID | 3854256 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]-diphenylmethanol |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)N1CCC(C(O)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26ClN3O3S/c1-17-21(22(24)26(2)25-17)31(29,30)27-15-13-20(14-16-27)23(28,18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,20,28H,13-16H2,1-2H3 |
| InChIKey | PQHUMCDCSBRPHP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |