C16H20ClN3O2S — CID 166186757
4-(2-benzylpyrrolidin-1-yl)sulfonyl-5-chloro-1,3-dimethylpyrazole (PubChem CID 166186757) has the molecular formula C16H20ClN3O2S and a molecular weight of 353.88 g/mol. Its IUPAC name is 4-(2-benzylpyrrolidin-1-yl)sulfonyl-5-chloro-1,3-dimethylpyrazole.
| Compound Name | 4-(2-benzylpyrrolidin-1-yl)sulfonyl-5-chloro-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 166186757 |
| Molecular Formula | C16H20ClN3O2S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-(2-benzylpyrrolidin-1-yl)sulfonyl-5-chloro-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)N1CCCC1Cc1ccccc1 |
| InChI | InChI=1S/C16H20ClN3O2S/c1-12-15(16(17)19(2)18-12)23(21,22)20-10-6-9-14(20)11-13-7-4-3-5-8-13/h3-5,7-8,14H,6,9-11H2,1-2H3 |
| InChIKey | DXKUUUVPUOMIJA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |