About ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate
ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate (PubChem CID 70752628) has the molecular formula C14H22ClN3O4S
and a molecular weight of 363.87 g/mol. Its IUPAC name is ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate |
| PubChem CID | 70752628 |
| Molecular Formula | C14H22ClN3O4S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate |
| SMILES | CCOC(=O)CC1CCCCN1S(=O)(=O)c1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C14H22ClN3O4S/c1-4-22-12(19)9-11-7-5-6-8-18(11)23(20,21)13-10(2)16-17(3)14(13)15/h11H,4-9H2,1-3H3 |
| InChIKey | RMCFAZYFPRBLID-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate?
The IUPAC name of ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate (CID 70752628) is ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate.
What is the SMILES notation for ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate?
The canonical SMILES for ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate is CCOC(=O)CC1CCCCN1S(=O)(=O)c1c(C)nn(C)c1Cl.
What is the InChIKey of ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate?
The InChIKey is RMCFAZYFPRBLID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22ClN3O4S/c1-4-22-12(19)9-11-7-5-6-8-18(11)23(20,21)13-10(2)16-17(3)14(13)15/h11H,4-9H2,1-3H3.
What are the key properties of ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate?
ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate has a molecular weight of 363.87 g/mol, XLogP of 1.88, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1-(5-chloro-1,3-dimethylpyrazol-4-yl)sulfonylpiperidin-2-yl]acetate is sourced from PubChem (CID 70752628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).