C13H22BrN3O2S — CID 80671277
2-(2-bromoethyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine (PubChem CID 80671277) has the molecular formula C13H22BrN3O2S and a molecular weight of 364.31 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine.
| Compound Name | 2-(2-bromoethyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine |
|---|---|
| PubChem CID | 80671277 |
| Molecular Formula | C13H22BrN3O2S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-(2-bromoethyl)-1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidine |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)N1CCCCC1CCBr |
| InChI | InChI=1S/C13H22BrN3O2S/c1-10-13(11(2)16(3)15-10)20(18,19)17-9-5-4-6-12(17)7-8-14/h12H,4-9H2,1-3H3 |
| InChIKey | SKPHQQWCVJVLHZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|