C17H18ClNO2S — CID 24627301
2-benzyl-1-(3-chlorophenyl)sulfonylpyrrolidine (PubChem CID 24627301) has the molecular formula C17H18ClNO2S and a molecular weight of 335.86 g/mol. Its IUPAC name is 2-benzyl-1-(3-chlorophenyl)sulfonylpyrrolidine.
| Compound Name | 2-benzyl-1-(3-chlorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 24627301 |
| Molecular Formula | C17H18ClNO2S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-benzyl-1-(3-chlorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N1CCCC1Cc1ccccc1 |
| InChI | InChI=1S/C17H18ClNO2S/c18-15-8-4-10-17(13-15)22(20,21)19-11-5-9-16(19)12-14-6-2-1-3-7-14/h1-4,6-8,10,13,16H,5,9,11-12H2 |
| InChIKey | HKQLOXMCCBHMJO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |