C17H18ClNO4S2 — CID 90585721
2-(benzenesulfonylmethyl)-1-(4-chlorophenyl)sulfonylpyrrolidine (PubChem CID 90585721) has the molecular formula C17H18ClNO4S2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1-(4-chlorophenyl)sulfonylpyrrolidine.
| Compound Name | 2-(benzenesulfonylmethyl)-1-(4-chlorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90585721 |
| Molecular Formula | C17H18ClNO4S2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1-(4-chlorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(CC1CCCN1S(=O)(=O)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H18ClNO4S2/c18-14-8-10-17(11-9-14)25(22,23)19-12-4-5-15(19)13-24(20,21)16-6-2-1-3-7-16/h1-3,6-11,15H,4-5,12-13H2 |
| InChIKey | LPTGNMAWXMUSBV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |