C23H23NO4S2 — CID 90587549
2-(benzenesulfonylmethyl)-1-(3-phenylphenyl)sulfonylpyrrolidine (PubChem CID 90587549) has the molecular formula C23H23NO4S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1-(3-phenylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(benzenesulfonylmethyl)-1-(3-phenylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90587549 |
| Molecular Formula | C23H23NO4S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1-(3-phenylphenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(CC1CCCN1S(=O)(=O)c1cccc(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO4S2/c25-29(26,22-13-5-2-6-14-22)18-21-12-8-16-24(21)30(27,28)23-15-7-11-20(17-23)19-9-3-1-4-10-19/h1-7,9-11,13-15,17,21H,8,12,16,18H2 |
| InChIKey | CMZSCWRJLRMJNY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |