C19H23NO5S2 — CID 90585735
2-(benzenesulfonylmethyl)-1-(2-methoxy-5-methylphenyl)sulfonylpyrrolidine (PubChem CID 90585735) has the molecular formula C19H23NO5S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1-(2-methoxy-5-methylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(benzenesulfonylmethyl)-1-(2-methoxy-5-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90585735 |
| Molecular Formula | C19H23NO5S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1-(2-methoxy-5-methylphenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1CCCC1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H23NO5S2/c1-15-10-11-18(25-2)19(13-15)27(23,24)20-12-6-7-16(20)14-26(21,22)17-8-4-3-5-9-17/h3-5,8-11,13,16H,6-7,12,14H2,1-2H3 |
| InChIKey | PYHJPBKFMGNQID-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |