C21H27NO4S2 — CID 90585751
2-(benzenesulfonylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidine (PubChem CID 90585751) has the molecular formula C21H27NO4S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(benzenesulfonylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90585751 |
| Molecular Formula | C21H27NO4S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1-(2,3,5,6-tetramethylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCCC2CS(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C21H27NO4S2/c1-15-13-16(2)18(4)21(17(15)3)28(25,26)22-12-8-9-19(22)14-27(23,24)20-10-6-5-7-11-20/h5-7,10-11,13,19H,8-9,12,14H2,1-4H3 |
| InChIKey | UHTYJTFFVWYTRV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |