C21H27NO4S2 — CID 90585750
2-(benzenesulfonylmethyl)-1-(4-tert-butylphenyl)sulfonylpyrrolidine (PubChem CID 90585750) has the molecular formula C21H27NO4S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is 2-(benzenesulfonylmethyl)-1-(4-tert-butylphenyl)sulfonylpyrrolidine.
| Compound Name | 2-(benzenesulfonylmethyl)-1-(4-tert-butylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 90585750 |
| Molecular Formula | C21H27NO4S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-(benzenesulfonylmethyl)-1-(4-tert-butylphenyl)sulfonylpyrrolidine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCCC2CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO4S2/c1-21(2,3)17-11-13-20(14-12-17)28(25,26)22-15-7-8-18(22)16-27(23,24)19-9-5-4-6-10-19/h4-6,9-14,18H,7-8,15-16H2,1-3H3 |
| InChIKey | AWFUERJEIOKMGU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |