C18H18FNO4S — CID 110607825
3-[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 110607825) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is 3-[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 3-[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 110607825 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 3-[2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCCC2Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H18FNO4S/c19-15-8-6-13(7-9-15)11-16-4-2-10-20(16)25(23,24)17-5-1-3-14(12-17)18(21)22/h1,3,5-9,12,16H,2,4,10-11H2,(H,21,22) |
| InChIKey | JXFFWBYXRWVMBO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |