C14H19NO4S — CID 75400479
1-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 75400479) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 75400479 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[3-[(2R)-2-(hydroxymethyl)piperidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1cccc(S(=O)(=O)N2CCCC[C@@H]2CO)c1 |
| InChI | InChI=1S/C14H19NO4S/c1-11(17)12-5-4-7-14(9-12)20(18,19)15-8-3-2-6-13(15)10-16/h4-5,7,9,13,16H,2-3,6,8,10H2,1H3/t13-/m1/s1 |
| InChIKey | XOZYRQVREUIGJT-CYBMUJFWSA-N |
| XLogP | 1.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |