C20H20FN3O4S — CID 123478458
N-(4-fluoro-3-isocyanophenyl)-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzamide (PubChem CID 123478458) has the molecular formula C20H20FN3O4S and a molecular weight of 417.46 g/mol. Its IUPAC name is N-(4-fluoro-3-isocyanophenyl)-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-(4-fluoro-3-isocyanophenyl)-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 123478458 |
| Molecular Formula | C20H20FN3O4S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-(4-fluoro-3-isocyanophenyl)-3-[2-(hydroxymethyl)piperidin-1-yl]sulfonylbenzamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2cccc(S(=O)(=O)N3CCCCC3CO)c2)ccc1F |
| InChI | InChI=1S/C20H20FN3O4S/c1-22-19-12-15(8-9-18(19)21)23-20(26)14-5-4-7-17(11-14)29(27,28)24-10-3-2-6-16(24)13-25/h4-5,7-9,11-12,16,25H,2-3,6,10,13H2,(H,23,26) |
| InChIKey | OOPVIZUBGPOWJJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|