C19H18FN3O4S — CID 123891124
N-(4-fluoro-3-isocyanophenyl)-3-(4-hydroxypiperidin-1-yl)sulfonylbenzamide (PubChem CID 123891124) has the molecular formula C19H18FN3O4S and a molecular weight of 403.44 g/mol. Its IUPAC name is N-(4-fluoro-3-isocyanophenyl)-3-(4-hydroxypiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4-fluoro-3-isocyanophenyl)-3-(4-hydroxypiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 123891124 |
| Molecular Formula | C19H18FN3O4S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-(4-fluoro-3-isocyanophenyl)-3-(4-hydroxypiperidin-1-yl)sulfonylbenzamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2cccc(S(=O)(=O)N3CCC(O)CC3)c2)ccc1F |
| InChI | InChI=1S/C19H18FN3O4S/c1-21-18-12-14(5-6-17(18)20)22-19(25)13-3-2-4-16(11-13)28(26,27)23-9-7-15(24)8-10-23/h2-6,11-12,15,24H,7-10H2,(H,22,25) |
| InChIKey | DFQARVDSMCLTML-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|