C22H19F4N3O2 — CID 159798289
3-[1,1-difluoro-2-(4-hydroxypiperidin-1-yl)prop-2-enyl]-4-fluoro-N-(4-fluoro-3-isocyanophenyl)benzamide (PubChem CID 159798289) has the molecular formula C22H19F4N3O2 and a molecular weight of 433.41 g/mol. Its IUPAC name is 3-[1,1-difluoro-2-(4-hydroxypiperidin-1-yl)prop-2-enyl]-4-fluoro-N-(4-fluoro-3-isocyanophenyl)benzamide.
| Compound Name | 3-[1,1-difluoro-2-(4-hydroxypiperidin-1-yl)prop-2-enyl]-4-fluoro-N-(4-fluoro-3-isocyanophenyl)benzamide |
|---|---|
| PubChem CID | 159798289 |
| Molecular Formula | C22H19F4N3O2 |
| Molecular Weight | 433.41 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 3-[1,1-difluoro-2-(4-hydroxypiperidin-1-yl)prop-2-enyl]-4-fluoro-N-(4-fluoro-3-isocyanophenyl)benzamide |
| SMILES | [C-]#[N+]c1cc(NC(=O)c2ccc(F)c(C(F)(F)C(=C)N3CCC(O)CC3)c2)ccc1F |
| InChI | InChI=1S/C22H19F4N3O2/c1-13(29-9-7-16(30)8-10-29)22(25,26)17-11-14(3-5-18(17)23)21(31)28-15-4-6-19(24)20(12-15)27-2/h3-6,11-12,16,30H,1,7-10H2,(H,28,31) |
| InChIKey | RFRDXACYHVVSCW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|