C25H25FN2O3S — CID 3436224
3-(4-benzylpiperidin-1-yl)sulfonyl-N-(4-fluorophenyl)benzamide (PubChem CID 3436224) has the molecular formula C25H25FN2O3S and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(4-benzylpiperidin-1-yl)sulfonyl-N-(4-fluorophenyl)benzamide.
| Compound Name | 3-(4-benzylpiperidin-1-yl)sulfonyl-N-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 3436224 |
| Molecular Formula | C25H25FN2O3S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 3-(4-benzylpiperidin-1-yl)sulfonyl-N-(4-fluorophenyl)benzamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(S(=O)(=O)N2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C25H25FN2O3S/c26-22-9-11-23(12-10-22)27-25(29)21-7-4-8-24(18-21)32(30,31)28-15-13-20(14-16-28)17-19-5-2-1-3-6-19/h1-12,18,20H,13-17H2,(H,27,29) |
| InChIKey | SBJDRHRGJBUVQW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |