C5H6ClIN2O3S — CID 143700914
iodo 5-chloro-1,3-dimethylpyrazole-4-sulfonate (PubChem CID 143700914) has the molecular formula C5H6ClIN2O3S and a molecular weight of 336.54 g/mol. Its IUPAC name is iodo 5-chloro-1,3-dimethylpyrazole-4-sulfonate.
| Compound Name | iodo 5-chloro-1,3-dimethylpyrazole-4-sulfonate |
|---|---|
| PubChem CID | 143700914 |
| Molecular Formula | C5H6ClIN2O3S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 335.88 |
| IUPAC Name | iodo 5-chloro-1,3-dimethylpyrazole-4-sulfonate |
| SMILES | Cc1nn(C)c(Cl)c1S(=O)(=O)OI |
| InChI | InChI=1S/C5H6ClIN2O3S/c1-3-4(13(10,11)12-7)5(6)9(2)8-3/h1-2H3 |
| InChIKey | PSNGHRVSJGTPAW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|