C5H6ClN3O4S — CID 130171290
1,5-dimethyl-3-nitropyrazole-4-sulfonyl chloride (PubChem CID 130171290) has the molecular formula C5H6ClN3O4S and a molecular weight of 239.64 g/mol. Its IUPAC name is 1,5-dimethyl-3-nitropyrazole-4-sulfonyl chloride.
| Compound Name | 1,5-dimethyl-3-nitropyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 130171290 |
| Molecular Formula | C5H6ClN3O4S |
| Molecular Weight | 239.64 g/mol |
| Exact Mass | 238.98 |
| IUPAC Name | 1,5-dimethyl-3-nitropyrazole-4-sulfonyl chloride |
| SMILES | Cc1c(S(=O)(=O)Cl)c([N+](=O)[O-])nn1C |
| InChI | InChI=1S/C5H6ClN3O4S/c1-3-4(14(6,12)13)5(9(10)11)7-8(3)2/h1-2H3 |
| InChIKey | COZIHPNAGYARLQ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.64 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|